C19H19N5 — CID 139953901
1,1-dimethyl-2-[4-(4-phenylphenyl)pyrimidin-2-yl]guanidine (PubChem CID 139953901) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 1,1-dimethyl-2-[4-(4-phenylphenyl)pyrimidin-2-yl]guanidine.
| Compound Name | 1,1-dimethyl-2-[4-(4-phenylphenyl)pyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 139953901 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1,1-dimethyl-2-[4-(4-phenylphenyl)pyrimidin-2-yl]guanidine |
| SMILES | CN(C)/C(N)=N\c1nccc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H19N5/c1-24(2)18(20)23-19-21-13-12-17(22-19)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-13H,1-2H3,(H2,20,21,22,23) |
| InChIKey | SXMFBXSFZYCRIF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|