C52H94O15Sn2 — CID 139957670
bis[5-(2-ethylhexyl)-5-hydroxy-2-octyl-4,7-dioxo-1,3,2-dioxastannepan-2-yl] 2-(2-ethylhexyl)-2-hydroxybutanedioate (PubChem CID 139957670) has the molecular formula C52H94O15Sn2 and a molecular weight of 1196.73 g/mol. Its IUPAC name is bis[5-(2-ethylhexyl)-5-hydroxy-2-octyl-4,7-dioxo-1,3,2-dioxastannepan-2-yl] 2-(2-ethylhexyl)-2-hydroxybutanedioate.
| Compound Name | bis[5-(2-ethylhexyl)-5-hydroxy-2-octyl-4,7-dioxo-1,3,2-dioxastannepan-2-yl] 2-(2-ethylhexyl)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 139957670 |
| Molecular Formula | C52H94O15Sn2 |
| Molecular Weight | 1196.73 g/mol |
| Exact Mass | 1198.46 |
| IUPAC Name | bis[5-(2-ethylhexyl)-5-hydroxy-2-octyl-4,7-dioxo-1,3,2-dioxastannepan-2-yl] 2-(2-ethylhexyl)-2-hydroxybutanedioate |
| SMILES | CCCCCCCC[Sn]1(OC(=O)CC(O)(CC(CC)CCCC)C(=O)O[Sn]2(CCCCCCCC)OC(=O)CC(O)(CC(CC)CCCC)C(=O)O2)OC(=O)CC(O)(CC(CC)CCCC)C(=O)O1 |
| InChI | InChI=1S/3C12H22O5.2C8H17.2Sn/c3*1-3-5-6-9(4-2)7-12(17,11(15)16)8-10(13)14;2*1-3-5-7-8-6-4-2;;/h3*9,17H,3-8H2,1-2H3,(H,13,14)(H,15,16);2*1,3-8H2,2H3;;/q;;;;;2*+3/p-6 |
| InChIKey | HBMDKXVBFLVRQL-UHFFFAOYSA-H |
| XLogP | 11.05 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1196.73 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|