C17H35O4P — CID 57350984
(5,9-diethyl-7-hydroxytridecan-7-yl)oxy-oxido-oxophosphanium (PubChem CID 57350984) has the molecular formula C17H35O4P and a molecular weight of 334.44 g/mol. Its IUPAC name is (5,9-diethyl-7-hydroxytridecan-7-yl)oxy-oxido-oxophosphanium.
| Compound Name | (5,9-diethyl-7-hydroxytridecan-7-yl)oxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 57350984 |
| Molecular Formula | C17H35O4P |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (5,9-diethyl-7-hydroxytridecan-7-yl)oxy-oxido-oxophosphanium |
| SMILES | CCCCC(CC)CC(O)(CC(CC)CCCC)O[P+](=O)[O-] |
| InChI | InChI=1S/C17H35O4P/c1-5-9-11-15(7-3)13-17(18,21-22(19)20)14-16(8-4)12-10-6-2/h15-16,18H,5-14H2,1-4H3 |
| InChIKey | NMCBOTGEWZKAAU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|