C36H37N3O3 — CID 139958451
ethyl 4-[7,7-bis[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carboxylate (PubChem CID 139958451) has the molecular formula C36H37N3O3 and a molecular weight of 559.71 g/mol. Its IUPAC name is ethyl 4-[7,7-bis[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-[7,7-bis[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 139958451 |
| Molecular Formula | C36H37N3O3 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | ethyl 4-[7,7-bis[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]-5-oxo-2-phenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC(=O)C1=CC=CC=CC=C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C36H37N3O3/c1-6-42-36(41)33-32(35(40)37-34(33)28-14-10-9-11-15-28)17-13-8-7-12-16-31(26-18-22-29(23-19-26)38(2)3)27-20-24-30(25-21-27)39(4)5/h7-25H,6H2,1-5H3,(H,37,40) |
| InChIKey | XABQWEQFICRJPL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|