C22H19NO6 — CID 102468125
4-[(Z)-[4-ethoxycarbonyl-5-(4-methoxyphenyl)-2-oxo-1H-pyrrol-3-ylidene]methyl]benzoic acid (PubChem CID 102468125) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-[(Z)-[4-ethoxycarbonyl-5-(4-methoxyphenyl)-2-oxo-1H-pyrrol-3-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[4-ethoxycarbonyl-5-(4-methoxyphenyl)-2-oxo-1H-pyrrol-3-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 102468125 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-[(Z)-[4-ethoxycarbonyl-5-(4-methoxyphenyl)-2-oxo-1H-pyrrol-3-ylidene]methyl]benzoic acid |
| SMILES | CCOC(=O)C1=C(c2ccc(OC)cc2)NC(=O)/C1=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H19NO6/c1-3-29-22(27)18-17(12-13-4-6-15(7-5-13)21(25)26)20(24)23-19(18)14-8-10-16(28-2)11-9-14/h4-12H,3H2,1-2H3,(H,23,24)(H,25,26)/b17-12- |
| InChIKey | COQRIBXMCPTVBL-ATVHPVEESA-N |
| XLogP | 2.88 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|