About 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene
6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene (PubChem CID 139960754) has the molecular formula C23H21F3
and a molecular weight of 354.42 g/mol. Its IUPAC name is 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene |
| PubChem CID | 139960754 |
| Molecular Formula | C23H21F3 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene |
| SMILES | CCCC1=CCc2c(ccc(C#Cc3ccc(CC)c(F)c3F)c2F)C1 |
| InChI | InChI=1S/C23H21F3/c1-3-5-15-6-13-20-19(14-15)12-11-17(21(20)24)9-10-18-8-7-16(4-2)22(25)23(18)26/h6-8,11-12H,3-5,13-14H2,1-2H3 |
| InChIKey | PAXIEHUCJUIHLO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene?
The IUPAC name of 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene (CID 139960754) is 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene.
What is the SMILES notation for 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene?
The canonical SMILES for 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene is CCCC1=CCc2c(ccc(C#Cc3ccc(CC)c(F)c3F)c2F)C1.
What is the InChIKey of 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene?
The InChIKey is PAXIEHUCJUIHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F3/c1-3-5-15-6-13-20-19(14-15)12-11-17(21(20)24)9-10-18-8-7-16(4-2)22(25)23(18)26/h6-8,11-12H,3-5,13-14H2,1-2H3.
What are the key properties of 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene?
6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene has a molecular weight of 354.42 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(4-ethyl-2,3-difluorophenyl)ethynyl]-5-fluoro-2-propyl-1,4-dihydronaphthalene is sourced from PubChem (CID 139960754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).