About 3-iodo-5-phenoxybenzoic acid
3-iodo-5-phenoxybenzoic acid (PubChem CID 139966945) has the molecular formula C13H9IO3
and a molecular weight of 340.12 g/mol. Its IUPAC name is 3-iodo-5-phenoxybenzoic acid.
Molecular Properties
| Compound Name | 3-iodo-5-phenoxybenzoic acid |
| PubChem CID | 139966945 |
| Molecular Formula | C13H9IO3 |
| Molecular Weight | 340.12 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 3-iodo-5-phenoxybenzoic acid |
| SMILES | O=C(O)c1cc(I)cc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C13H9IO3/c14-10-6-9(13(15)16)7-12(8-10)17-11-4-2-1-3-5-11/h1-8H,(H,15,16) |
| InChIKey | UIQANRMNVWAOBS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-5-phenoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-5-phenoxybenzoic acid?
The IUPAC name of 3-iodo-5-phenoxybenzoic acid (CID 139966945) is 3-iodo-5-phenoxybenzoic acid.
What is the SMILES notation for 3-iodo-5-phenoxybenzoic acid?
The canonical SMILES for 3-iodo-5-phenoxybenzoic acid is O=C(O)c1cc(I)cc(Oc2ccccc2)c1.
What is the InChIKey of 3-iodo-5-phenoxybenzoic acid?
The InChIKey is UIQANRMNVWAOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9IO3/c14-10-6-9(13(15)16)7-12(8-10)17-11-4-2-1-3-5-11/h1-8H,(H,15,16).
What are the key properties of 3-iodo-5-phenoxybenzoic acid?
3-iodo-5-phenoxybenzoic acid has a molecular weight of 340.12 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-5-phenoxybenzoic acid is sourced from PubChem (CID 139966945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).