C19H30O14 — CID 139967585
(Z)-4-[3,3-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propoxy]-4-oxobut-2-enoic acid (PubChem CID 139967585) has the molecular formula C19H30O14 and a molecular weight of 482.44 g/mol. Its IUPAC name is (Z)-4-[3,3-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[3,3-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 139967585 |
| Molecular Formula | C19H30O14 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (Z)-4-[3,3-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)OCCC(C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30O14/c20-5-8-12(25)14(27)16(29)18(32-8)7(3-4-31-11(24)2-1-10(22)23)19-17(30)15(28)13(26)9(6-21)33-19/h1-2,7-9,12-21,25-30H,3-6H2,(H,22,23)/b2-1-/t7?,8-,9-,12-,13-,14+,15+,16-,17-,18?,19?/m1/s1 |
| InChIKey | DPSPNZMMTRAMHY-DZGSYPPZSA-N |
| XLogP | -5.14 |
| TPSA | 243.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | -5.14 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|