C29H36NO3P — CID 139968013
methyl 4-[4-[1-(diphenylphosphorylamino)hexyl]phenyl]butanoate (PubChem CID 139968013) has the molecular formula C29H36NO3P and a molecular weight of 477.59 g/mol. Its IUPAC name is methyl 4-[4-[1-(diphenylphosphorylamino)hexyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[1-(diphenylphosphorylamino)hexyl]phenyl]butanoate |
|---|---|
| PubChem CID | 139968013 |
| Molecular Formula | C29H36NO3P |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | methyl 4-[4-[1-(diphenylphosphorylamino)hexyl]phenyl]butanoate |
| SMILES | CCCCCC(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C29H36NO3P/c1-3-4-7-18-28(25-22-20-24(21-23-25)13-12-19-29(31)33-2)30-34(32,26-14-8-5-9-15-26)27-16-10-6-11-17-27/h5-6,8-11,14-17,20-23,28H,3-4,7,12-13,18-19H2,1-2H3,(H,30,32) |
| InChIKey | FFDFNJKESYSQOW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|