C19H22F6O2 — CID 139968720
5-[2-(4-butylcyclohexyl)-1,1,2,2-tetrafluoroethyl]-2,2-difluoro-1,3-benzodioxole (PubChem CID 139968720) has the molecular formula C19H22F6O2 and a molecular weight of 396.37 g/mol. Its IUPAC name is 5-[2-(4-butylcyclohexyl)-1,1,2,2-tetrafluoroethyl]-2,2-difluoro-1,3-benzodioxole.
| Compound Name | 5-[2-(4-butylcyclohexyl)-1,1,2,2-tetrafluoroethyl]-2,2-difluoro-1,3-benzodioxole |
|---|---|
| PubChem CID | 139968720 |
| Molecular Formula | C19H22F6O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 5-[2-(4-butylcyclohexyl)-1,1,2,2-tetrafluoroethyl]-2,2-difluoro-1,3-benzodioxole |
| SMILES | CCCCC1CCC(C(F)(F)C(F)(F)c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C19H22F6O2/c1-2-3-4-12-5-7-13(8-6-12)17(20,21)18(22,23)14-9-10-15-16(11-14)27-19(24,25)26-15/h9-13H,2-8H2,1H3 |
| InChIKey | LTXHLHTWUAFAMG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|