C27H31F3N6O3 — CID 139969359
[8-cyclopentyl-7-oxo-2-(4-piperazin-1-ylanilino)-5-propylpyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 139969359) has the molecular formula C27H31F3N6O3 and a molecular weight of 544.58 g/mol. Its IUPAC name is [8-cyclopentyl-7-oxo-2-(4-piperazin-1-ylanilino)-5-propylpyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [8-cyclopentyl-7-oxo-2-(4-piperazin-1-ylanilino)-5-propylpyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139969359 |
| Molecular Formula | C27H31F3N6O3 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | [8-cyclopentyl-7-oxo-2-(4-piperazin-1-ylanilino)-5-propylpyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CCCc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)cc3)nc(OC(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C27H31F3N6O3/c1-2-5-17-16-21(37)36(20-6-3-4-7-20)23-22(17)24(39-25(38)27(28,29)30)34-26(33-23)32-18-8-10-19(11-9-18)35-14-12-31-13-15-35/h8-11,16,20,31H,2-7,12-15H2,1H3,(H,32,33,34) |
| InChIKey | LBJJRJAJOFCFNO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|