C25H27F3N6O3 — CID 139969369
[8-cyclopentyl-5-methyl-7-oxo-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 139969369) has the molecular formula C25H27F3N6O3 and a molecular weight of 516.52 g/mol. Its IUPAC name is [8-cyclopentyl-5-methyl-7-oxo-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [8-cyclopentyl-5-methyl-7-oxo-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139969369 |
| Molecular Formula | C25H27F3N6O3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [8-cyclopentyl-5-methyl-7-oxo-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)cc3)nc(OC(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C25H27F3N6O3/c1-15-14-19(35)34(18-4-2-3-5-18)21-20(15)22(37-23(36)25(26,27)28)32-24(31-21)30-16-6-8-17(9-7-16)33-12-10-29-11-13-33/h6-9,14,18,29H,2-5,10-13H2,1H3,(H,30,31,32) |
| InChIKey | SRQLAMODNYXPND-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|