C25H26ClF3N6O3 — CID 139969371
[2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 139969371) has the molecular formula C25H26ClF3N6O3 and a molecular weight of 550.97 g/mol. Its IUPAC name is [2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139969371 |
| Molecular Formula | C25H26ClF3N6O3 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | [2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)c(Cl)c3)nc(OC(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C25H26ClF3N6O3/c1-14-12-19(36)35(16-4-2-3-5-16)21-20(14)22(38-23(37)25(27,28)29)33-24(32-21)31-15-6-7-18(17(26)13-15)34-10-8-30-9-11-34/h6-7,12-13,16,30H,2-5,8-11H2,1H3,(H,31,32,33) |
| InChIKey | AWOFOBFDRAJSGV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|