C27H28F6N6O3 — CID 139969363
[8-cyclopentyl-5-methyl-7-oxo-2-[4-[3-(2,2,2-trifluoroethylamino)pyrrolidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 139969363) has the molecular formula C27H28F6N6O3 and a molecular weight of 598.55 g/mol. Its IUPAC name is [8-cyclopentyl-5-methyl-7-oxo-2-[4-[3-(2,2,2-trifluoroethylamino)pyrrolidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [8-cyclopentyl-5-methyl-7-oxo-2-[4-[3-(2,2,2-trifluoroethylamino)pyrrolidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139969363 |
| Molecular Formula | C27H28F6N6O3 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | [8-cyclopentyl-5-methyl-7-oxo-2-[4-[3-(2,2,2-trifluoroethylamino)pyrrolidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCC(NCC(F)(F)F)C4)cc3)nc(OC(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C27H28F6N6O3/c1-15-12-20(40)39(19-4-2-3-5-19)22-21(15)23(42-24(41)27(31,32)33)37-25(36-22)35-16-6-8-18(9-7-16)38-11-10-17(13-38)34-14-26(28,29)30/h6-9,12,17,19,34H,2-5,10-11,13-14H2,1H3,(H,35,36,37) |
| InChIKey | SDIAPPXVYXOXLH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|