C36H27F9N2O6 — CID 139973457
[4-[2-oxo-2-[3-oxo-2-phenyl-3-(2,2,2-trifluoroethylamino)-2-(2,2,2-trifluoroethylcarbamoyl)propoxy]ethyl]phenyl] 2-phenyl-5-(trifluoromethyl)benzoate (PubChem CID 139973457) has the molecular formula C36H27F9N2O6 and a molecular weight of 754.60 g/mol. Its IUPAC name is [4-[2-oxo-2-[3-oxo-2-phenyl-3-(2,2,2-trifluoroethylamino)-2-(2,2,2-trifluoroethylcarbamoyl)propoxy]ethyl]phenyl] 2-phenyl-5-(trifluoromethyl)benzoate.
| Compound Name | [4-[2-oxo-2-[3-oxo-2-phenyl-3-(2,2,2-trifluoroethylamino)-2-(2,2,2-trifluoroethylcarbamoyl)propoxy]ethyl]phenyl] 2-phenyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 139973457 |
| Molecular Formula | C36H27F9N2O6 |
| Molecular Weight | 754.60 g/mol |
| Exact Mass | 754.17 |
| IUPAC Name | [4-[2-oxo-2-[3-oxo-2-phenyl-3-(2,2,2-trifluoroethylamino)-2-(2,2,2-trifluoroethylcarbamoyl)propoxy]ethyl]phenyl] 2-phenyl-5-(trifluoromethyl)benzoate |
| SMILES | O=C(Cc1ccc(OC(=O)c2cc(C(F)(F)F)ccc2-c2ccccc2)cc1)OCC(C(=O)NCC(F)(F)F)(C(=O)NCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C36H27F9N2O6/c37-34(38,39)19-46-31(50)33(24-9-5-2-6-10-24,32(51)47-20-35(40,41)42)21-52-29(48)17-22-11-14-26(15-12-22)53-30(49)28-18-25(36(43,44)45)13-16-27(28)23-7-3-1-4-8-23/h1-16,18H,17,19-21H2,(H,46,50)(H,47,51) |
| InChIKey | MOEDVLHQEQTLAS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|