C34H43ClN6O3 — CID 139973664
tert-butyl 4-[5-[5-[3-(3-chlorophenoxy)phenyl]imino-2-methyl-6,7-dihydropyrido[2,3-d]pyrimidin-8-yl]pentyl]piperazine-1-carboxylate (PubChem CID 139973664) has the molecular formula C34H43ClN6O3 and a molecular weight of 619.21 g/mol. Its IUPAC name is tert-butyl 4-[5-[5-[3-(3-chlorophenoxy)phenyl]imino-2-methyl-6,7-dihydropyrido[2,3-d]pyrimidin-8-yl]pentyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[5-[3-(3-chlorophenoxy)phenyl]imino-2-methyl-6,7-dihydropyrido[2,3-d]pyrimidin-8-yl]pentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139973664 |
| Molecular Formula | C34H43ClN6O3 |
| Molecular Weight | 619.21 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | tert-butyl 4-[5-[5-[3-(3-chlorophenoxy)phenyl]imino-2-methyl-6,7-dihydropyrido[2,3-d]pyrimidin-8-yl]pentyl]piperazine-1-carboxylate |
| SMILES | Cc1ncc2c(n1)N(CCCCCN1CCN(C(=O)OC(C)(C)C)CC1)CC/C2=N\c1cccc(Oc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C34H43ClN6O3/c1-25-36-24-30-31(38-27-11-9-13-29(23-27)43-28-12-8-10-26(35)22-28)14-17-40(32(30)37-25)16-7-5-6-15-39-18-20-41(21-19-39)33(42)44-34(2,3)4/h8-13,22-24H,5-7,14-21H2,1-4H3/b38-31+ |
| InChIKey | RJQDCJITNAYHMT-KPITYXSVSA-N |
| XLogP | 7.28 |
| TPSA | 83.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.21 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|