C21H25Cl3N2O4 — CID 139974050
2-O-(3,3-dimethylbutyl) 9-O-(2,2,2-trichloroethyl) 3,4-dihydro-1H-pyrido[3,4-b]indole-2,9-dicarboxylate (PubChem CID 139974050) has the molecular formula C21H25Cl3N2O4 and a molecular weight of 475.80 g/mol. Its IUPAC name is 2-O-(3,3-dimethylbutyl) 9-O-(2,2,2-trichloroethyl) 3,4-dihydro-1H-pyrido[3,4-b]indole-2,9-dicarboxylate.
| Compound Name | 2-O-(3,3-dimethylbutyl) 9-O-(2,2,2-trichloroethyl) 3,4-dihydro-1H-pyrido[3,4-b]indole-2,9-dicarboxylate |
|---|---|
| PubChem CID | 139974050 |
| Molecular Formula | C21H25Cl3N2O4 |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2-O-(3,3-dimethylbutyl) 9-O-(2,2,2-trichloroethyl) 3,4-dihydro-1H-pyrido[3,4-b]indole-2,9-dicarboxylate |
| SMILES | CC(C)(C)CCOC(=O)N1CCc2c(n(C(=O)OCC(Cl)(Cl)Cl)c3ccccc23)C1 |
| InChI | InChI=1S/C21H25Cl3N2O4/c1-20(2,3)9-11-29-18(27)25-10-8-15-14-6-4-5-7-16(14)26(17(15)12-25)19(28)30-13-21(22,23)24/h4-7H,8-13H2,1-3H3 |
| InChIKey | ZTXSZIOGQNOTDZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|