C36H48NOP — CID 139974466
2-[1,3-ditert-butyl-2-(2,4,6-trimethylphenyl)iminophospholan-3-yl]-6-(2-phenylpropan-2-yl)phenol (PubChem CID 139974466) has the molecular formula C36H48NOP and a molecular weight of 541.76 g/mol. Its IUPAC name is 2-[1,3-ditert-butyl-2-(2,4,6-trimethylphenyl)iminophospholan-3-yl]-6-(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-[1,3-ditert-butyl-2-(2,4,6-trimethylphenyl)iminophospholan-3-yl]-6-(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 139974466 |
| Molecular Formula | C36H48NOP |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | 2-[1,3-ditert-butyl-2-(2,4,6-trimethylphenyl)iminophospholan-3-yl]-6-(2-phenylpropan-2-yl)phenol |
| SMILES | Cc1cc(C)c(/N=C2\P(C(C)(C)C)CCC2(c2cccc(C(C)(C)c3ccccc3)c2O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C36H48NOP/c1-24-22-25(2)30(26(3)23-24)37-32-36(33(4,5)6,20-21-39(32)34(7,8)9)29-19-15-18-28(31(29)38)35(10,11)27-16-13-12-14-17-27/h12-19,22-23,38H,20-21H2,1-11H3/b37-32- |
| InChIKey | RGAXBHNUCQEZPP-FTTXPQLCSA-N |
| XLogP | 10.34 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|