C29H42NOP — CID 139974382
2-tert-butyl-6-(1,3-ditert-butyl-2-phenyliminophospholan-3-yl)-4-methylphenol (PubChem CID 139974382) has the molecular formula C29H42NOP and a molecular weight of 451.64 g/mol. Its IUPAC name is 2-tert-butyl-6-(1,3-ditert-butyl-2-phenyliminophospholan-3-yl)-4-methylphenol.
| Compound Name | 2-tert-butyl-6-(1,3-ditert-butyl-2-phenyliminophospholan-3-yl)-4-methylphenol |
|---|---|
| PubChem CID | 139974382 |
| Molecular Formula | C29H42NOP |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 2-tert-butyl-6-(1,3-ditert-butyl-2-phenyliminophospholan-3-yl)-4-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C2(C(C)(C)C)CCP(C(C)(C)C)/C2=N\c2ccccc2)c1 |
| InChI | InChI=1S/C29H42NOP/c1-20-18-22(26(2,3)4)24(31)23(19-20)29(27(5,6)7)16-17-32(28(8,9)10)25(29)30-21-14-12-11-13-15-21/h11-15,18-19,31H,16-17H2,1-10H3/b30-25- |
| InChIKey | ZEEFEBQBFQXRNV-JVCXMKTPSA-N |
| XLogP | 8.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|