C33H44NOP — CID 139974348
2-tert-butyl-6-(1,3-ditert-butyl-2-naphthalen-1-yliminophospholan-3-yl)-4-methylphenol (PubChem CID 139974348) has the molecular formula C33H44NOP and a molecular weight of 501.70 g/mol. Its IUPAC name is 2-tert-butyl-6-(1,3-ditert-butyl-2-naphthalen-1-yliminophospholan-3-yl)-4-methylphenol.
| Compound Name | 2-tert-butyl-6-(1,3-ditert-butyl-2-naphthalen-1-yliminophospholan-3-yl)-4-methylphenol |
|---|---|
| PubChem CID | 139974348 |
| Molecular Formula | C33H44NOP |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 2-tert-butyl-6-(1,3-ditert-butyl-2-naphthalen-1-yliminophospholan-3-yl)-4-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C2(C(C)(C)C)CCP(C(C)(C)C)/C2=N\c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C33H44NOP/c1-22-20-25(30(2,3)4)28(35)26(21-22)33(31(5,6)7)18-19-36(32(8,9)10)29(33)34-27-17-13-15-23-14-11-12-16-24(23)27/h11-17,20-21,35H,18-19H2,1-10H3/b34-29- |
| InChIKey | SWBAMZUQRCBADU-BNIPGBBVSA-N |
| XLogP | 9.85 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|