C13H13NO2S4 — CID 139974761
7-(4-methylphenyl)sulfonyl-1,5-dihydrotrithiepino[5,6-c]pyrrole (PubChem CID 139974761) has the molecular formula C13H13NO2S4 and a molecular weight of 343.52 g/mol. Its IUPAC name is 7-(4-methylphenyl)sulfonyl-1,5-dihydrotrithiepino[5,6-c]pyrrole.
| Compound Name | 7-(4-methylphenyl)sulfonyl-1,5-dihydrotrithiepino[5,6-c]pyrrole |
|---|---|
| PubChem CID | 139974761 |
| Molecular Formula | C13H13NO2S4 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 7-(4-methylphenyl)sulfonyl-1,5-dihydrotrithiepino[5,6-c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc3c(c2)CSSSC3)cc1 |
| InChI | InChI=1S/C13H13NO2S4/c1-10-2-4-13(5-3-10)20(15,16)14-6-11-8-17-19-18-9-12(11)7-14/h2-7H,8-9H2,1H3 |
| InChIKey | COBRANPIVKWOQO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|