C33H34F6N2O9 — CID 139975874
3-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethoxymethyl)-8,13,16-trioxa-3,14-diazadispiro[5.0.67.36]hexadec-10-ene-9,12,15-trione (PubChem CID 139975874) has the molecular formula C33H34F6N2O9 and a molecular weight of 716.63 g/mol. Its IUPAC name is 3-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethoxymethyl)-8,13,16-trioxa-3,14-diazadispiro[5.0.67.36]hexadec-10-ene-9,12,15-trione.
| Compound Name | 3-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethoxymethyl)-8,13,16-trioxa-3,14-diazadispiro[5.0.67.36]hexadec-10-ene-9,12,15-trione |
|---|---|
| PubChem CID | 139975874 |
| Molecular Formula | C33H34F6N2O9 |
| Molecular Weight | 716.63 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | 3-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethoxymethyl)-8,13,16-trioxa-3,14-diazadispiro[5.0.67.36]hexadec-10-ene-9,12,15-trione |
| SMILES | COCCOCN1C(=O)OC2(CCN(CCCOC(c3cccc(C(F)(F)F)c3)c3cccc(C(F)(F)F)c3)CC2)C12OC(=O)C=CC(=O)O2 |
| InChI | InChI=1S/C33H34F6N2O9/c1-45-17-18-46-21-41-29(44)50-30(33(41)48-26(42)9-10-27(43)49-33)11-14-40(15-12-30)13-4-16-47-28(22-5-2-7-24(19-22)31(34,35)36)23-6-3-8-25(20-23)32(37,38)39/h2-3,5-10,19-20,28H,4,11-18,21H2,1H3 |
| InChIKey | QDCPHDDHVCCYDU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|