C29H28F6N2O7S — CID 139975818
9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(methylsulfanylmethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione (PubChem CID 139975818) has the molecular formula C29H28F6N2O7S and a molecular weight of 662.61 g/mol. Its IUPAC name is 9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(methylsulfanylmethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione.
| Compound Name | 9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(methylsulfanylmethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione |
|---|---|
| PubChem CID | 139975818 |
| Molecular Formula | C29H28F6N2O7S |
| Molecular Weight | 662.61 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | 9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(methylsulfanylmethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione |
| SMILES | CSCN1C(=O)OC2(CCN(CCCOC(c3cccc(C(F)(F)F)c3)c3cccc(C(F)(F)F)c3)CC2)C12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C29H28F6N2O7S/c1-45-17-37-25(40)44-26(29(37)42-23(38)24(39)43-29)9-12-36(13-10-26)11-4-14-41-22(18-5-2-7-20(15-18)27(30,31)32)19-6-3-8-21(16-19)28(33,34)35/h2-3,5-8,15-16,22H,4,9-14,17H2,1H3 |
| InChIKey | OBZDOEJMGWZTIT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|