C25H24FN9O — CID 139976114
2-N-(2-fluoro-4-methoxyphenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine (PubChem CID 139976114) has the molecular formula C25H24FN9O and a molecular weight of 485.53 g/mol. Its IUPAC name is 2-N-(2-fluoro-4-methoxyphenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(2-fluoro-4-methoxyphenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976114 |
| Molecular Formula | C25H24FN9O |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-N-(2-fluoro-4-methoxyphenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(NN=C(C)c3ccncc3)cc(NN=C(C)c3ccncc3)n2)c(F)c1 |
| InChI | InChI=1S/C25H24FN9O/c1-16(18-6-10-27-11-7-18)32-34-23-15-24(35-33-17(2)19-8-12-28-13-9-19)31-25(30-23)29-22-5-4-20(36-3)14-21(22)26/h4-15H,1-3H3,(H3,29,30,31,34,35) |
| InChIKey | ZDGMUXSIHWPQGG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|