C28H28F3N9O4S2 — CID 139976970
N-methyl-4-[C-methyl-N-[[6-[2-[1-[4-(methylsulfamoyl)phenyl]ethylidene]hydrazinyl]-2-(2,4,5-trifluoroanilino)pyrimidin-4-yl]amino]carbonimidoyl]benzenesulfonamide (PubChem CID 139976970) has the molecular formula C28H28F3N9O4S2 and a molecular weight of 675.72 g/mol. Its IUPAC name is N-methyl-4-[C-methyl-N-[[6-[2-[1-[4-(methylsulfamoyl)phenyl]ethylidene]hydrazinyl]-2-(2,4,5-trifluoroanilino)pyrimidin-4-yl]amino]carbonimidoyl]benzenesulfonamide.
| Compound Name | N-methyl-4-[C-methyl-N-[[6-[2-[1-[4-(methylsulfamoyl)phenyl]ethylidene]hydrazinyl]-2-(2,4,5-trifluoroanilino)pyrimidin-4-yl]amino]carbonimidoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139976970 |
| Molecular Formula | C28H28F3N9O4S2 |
| Molecular Weight | 675.72 g/mol |
| Exact Mass | 675.17 |
| IUPAC Name | N-methyl-4-[C-methyl-N-[[6-[2-[1-[4-(methylsulfamoyl)phenyl]ethylidene]hydrazinyl]-2-(2,4,5-trifluoroanilino)pyrimidin-4-yl]amino]carbonimidoyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C(C)=NNc2cc(NN=C(C)c3ccc(S(=O)(=O)NC)cc3)nc(Nc3cc(F)c(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C28H28F3N9O4S2/c1-16(18-5-9-20(10-6-18)45(41,42)32-3)37-39-26-15-27(36-28(35-26)34-25-14-23(30)22(29)13-24(25)31)40-38-17(2)19-7-11-21(12-8-19)46(43,44)33-4/h5-15,32-33H,1-4H3,(H3,34,35,36,39,40) |
| InChIKey | ADOCFGSEKTWNQH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 178.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|