C28H28N6O4S2 — CID 139976484
4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-phenylpyrimidine-4,6-diamine (PubChem CID 139976484) has the molecular formula C28H28N6O4S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is 4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 139976484 |
| Molecular Formula | C28H28N6O4S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-phenylpyrimidine-4,6-diamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccc(S(C)(=O)=O)cc2)nc(-c2ccccc2)n1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H28N6O4S2/c1-19(21-10-14-24(15-11-21)39(3,35)36)31-33-26-18-27(30-28(29-26)23-8-6-5-7-9-23)34-32-20(2)22-12-16-25(17-13-22)40(4,37)38/h5-18H,1-4H3,(H2,29,30,33,34) |
| InChIKey | IPSJPNZYYXLJAP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|