C29H27ClF3N7O5S2 — CID 139976821
2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 139976821) has the molecular formula C29H27ClF3N7O5S2 and a molecular weight of 710.16 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976821 |
| Molecular Formula | C29H27ClF3N7O5S2 |
| Molecular Weight | 710.16 g/mol |
| Exact Mass | 709.12 |
| IUPAC Name | 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccc(S(C)(=O)=O)cc2)nc(Nc2ccc(OC(F)(F)F)c(Cl)c2)n1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C29H27ClF3N7O5S2/c1-17(19-5-10-22(11-6-19)46(3,41)42)37-39-26-16-27(40-38-18(2)20-7-12-23(13-8-20)47(4,43)44)36-28(35-26)34-21-9-14-25(24(30)15-21)45-29(31,32)33/h5-16H,1-4H3,(H3,34,35,36,39,40) |
| InChIKey | QKNLSKQRQXSRKE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.16 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|