C29H31N7O5S2 — CID 139976110
5-methoxy-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976110) has the molecular formula C29H31N7O5S2 and a molecular weight of 621.75 g/mol. Its IUPAC name is 5-methoxy-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 5-methoxy-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976110 |
| Molecular Formula | C29H31N7O5S2 |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | 5-methoxy-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | COc1c(NN=C(C)c2ccc(S(C)(=O)=O)cc2)nc(Nc2ccccc2)nc1NN=C(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C29H31N7O5S2/c1-19(21-11-15-24(16-12-21)42(4,37)38)33-35-27-26(41-3)28(32-29(31-27)30-23-9-7-6-8-10-23)36-34-20(2)22-13-17-25(18-14-22)43(5,39)40/h6-18H,1-5H3,(H3,30,31,32,35,36) |
| InChIKey | FDBOAQWFIPDBNN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|