C28H27ClFN7O4S2 — CID 139976869
2-N-(3-chloro-4-fluorophenyl)-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 139976869) has the molecular formula C28H27ClFN7O4S2 and a molecular weight of 644.15 g/mol. Its IUPAC name is 2-N-(3-chloro-4-fluorophenyl)-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(3-chloro-4-fluorophenyl)-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976869 |
| Molecular Formula | C28H27ClFN7O4S2 |
| Molecular Weight | 644.15 g/mol |
| Exact Mass | 643.12 |
| IUPAC Name | 2-N-(3-chloro-4-fluorophenyl)-4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccc(S(C)(=O)=O)cc2)nc(Nc2ccc(F)c(Cl)c2)n1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H27ClFN7O4S2/c1-17(19-5-10-22(11-6-19)42(3,38)39)34-36-26-16-27(33-28(32-26)31-21-9-14-25(30)24(29)15-21)37-35-18(2)20-7-12-23(13-8-20)43(4,40)41/h5-16H,1-4H3,(H3,31,32,33,36,37) |
| InChIKey | YPENWTRKHMNWHQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.15 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|