C28H26F3N7O4S2 — CID 139976243
4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine (PubChem CID 139976243) has the molecular formula C28H26F3N7O4S2 and a molecular weight of 645.69 g/mol. Its IUPAC name is 4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976243 |
| Molecular Formula | C28H26F3N7O4S2 |
| Molecular Weight | 645.69 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | 4-N,6-N-bis[1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccc(S(C)(=O)=O)cc2)nc(Nc2ccc(F)c(F)c2F)n1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H26F3N7O4S2/c1-16(18-5-9-20(10-6-18)43(3,39)40)35-37-24-15-25(34-28(33-24)32-23-14-13-22(29)26(30)27(23)31)38-36-17(2)19-7-11-21(12-8-19)44(4,41)42/h5-15H,1-4H3,(H3,32,33,34,37,38) |
| InChIKey | BJFISBNVVQIQNT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|