C34H32FN7O4S2 — CID 11763864
5-(3-fluorophenyl)-4-N,6-N-bis[(E)-1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 11763864) has the molecular formula C34H32FN7O4S2 and a molecular weight of 685.81 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-N,6-N-bis[(E)-1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 5-(3-fluorophenyl)-4-N,6-N-bis[(E)-1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 11763864 |
| Molecular Formula | C34H32FN7O4S2 |
| Molecular Weight | 685.81 g/mol |
| Exact Mass | 685.19 |
| IUPAC Name | 5-(3-fluorophenyl)-4-N,6-N-bis[(E)-1-(4-methylsulfonylphenyl)ethylideneamino]-2-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | C/C(=N\Nc1nc(Nc2ccccc2)nc(N/N=C(\C)c2ccc(S(C)(=O)=O)cc2)c1-c1cccc(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C34H32FN7O4S2/c1-22(24-13-17-29(18-14-24)47(3,43)44)39-41-32-31(26-9-8-10-27(35)21-26)33(38-34(37-32)36-28-11-6-5-7-12-28)42-40-23(2)25-15-19-30(20-16-25)48(4,45)46/h5-21H,1-4H3,(H3,36,37,38,41,42)/b39-22+,40-23+ |
| InChIKey | FZJAICNCZYPBGI-YGLZRDFESA-N |
| XLogP | 6.51 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.81 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|