C25H21ClF3N9S — CID 139976491
2-N-[3-chloro-4-(trifluoromethylsulfanyl)phenyl]-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine (PubChem CID 139976491) has the molecular formula C25H21ClF3N9S and a molecular weight of 572.02 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(trifluoromethylsulfanyl)phenyl]-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-[3-chloro-4-(trifluoromethylsulfanyl)phenyl]-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976491 |
| Molecular Formula | C25H21ClF3N9S |
| Molecular Weight | 572.02 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 2-N-[3-chloro-4-(trifluoromethylsulfanyl)phenyl]-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccncc2)nc(Nc2ccc(SC(F)(F)F)c(Cl)c2)n1)c1ccncc1 |
| InChI | InChI=1S/C25H21ClF3N9S/c1-15(17-5-9-30-10-6-17)35-37-22-14-23(38-36-16(2)18-7-11-31-12-8-18)34-24(33-22)32-19-3-4-21(20(26)13-19)39-25(27,28)29/h3-14H,1-2H3,(H3,32,33,34,37,38) |
| InChIKey | RJUCPSFXABIODR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.02 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|