C20H20F3NO5 — CID 139985258
ethyl 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenoxy]acetate (PubChem CID 139985258) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is ethyl 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139985258 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethyl 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H20F3NO5/c1-3-28-18(25)12-29-15-8-9-17(27-2)16(10-15)19(26)24-11-13-4-6-14(7-5-13)20(21,22)23/h4-10H,3,11-12H2,1-2H3,(H,24,26) |
| InChIKey | DUFODWOXOQTHRS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |