C23H15F5N2O — CID 139985783
2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline (PubChem CID 139985783) has the molecular formula C23H15F5N2O and a molecular weight of 430.38 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 139985783 |
| Molecular Formula | C23H15F5N2O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline |
| SMILES | Fc1c(F)c(F)c(NC(=CC2=NC(c3ccccc3)CO2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C23H15F5N2O/c24-18-19(25)21(27)23(22(28)20(18)26)30-15(13-7-3-1-4-8-13)11-17-29-16(12-31-17)14-9-5-2-6-10-14/h1-11,16,30H,12H2 |
| InChIKey | IPVWUTSDPVIUSL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|