C18H26N2O2Si — CID 139986719
2-trimethylsilylethyl 4-[3-(aminomethyl)phenyl]-2H-pyridine-1-carboxylate (PubChem CID 139986719) has the molecular formula C18H26N2O2Si and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-[3-(aminomethyl)phenyl]-2H-pyridine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 4-[3-(aminomethyl)phenyl]-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 139986719 |
| Molecular Formula | C18H26N2O2Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-trimethylsilylethyl 4-[3-(aminomethyl)phenyl]-2H-pyridine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1C=CC(c2cccc(CN)c2)=CC1 |
| InChI | InChI=1S/C18H26N2O2Si/c1-23(2,3)12-11-22-18(21)20-9-7-16(8-10-20)17-6-4-5-15(13-17)14-19/h4-9,13H,10-12,14,19H2,1-3H3 |
| InChIKey | UTIBEHRZWPXGBB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|