C13H22NO6PSi — CID 139986855
[2-[hydroxy(2-trimethylsilylethoxy)phosphoryl]oxyphenyl]methyl carbamate (PubChem CID 139986855) has the molecular formula C13H22NO6PSi and a molecular weight of 347.38 g/mol. Its IUPAC name is [2-[hydroxy(2-trimethylsilylethoxy)phosphoryl]oxyphenyl]methyl carbamate.
| Compound Name | [2-[hydroxy(2-trimethylsilylethoxy)phosphoryl]oxyphenyl]methyl carbamate |
|---|---|
| PubChem CID | 139986855 |
| Molecular Formula | C13H22NO6PSi |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [2-[hydroxy(2-trimethylsilylethoxy)phosphoryl]oxyphenyl]methyl carbamate |
| SMILES | C[Si](C)(C)CCOP(=O)(O)Oc1ccccc1COC(N)=O |
| InChI | InChI=1S/C13H22NO6PSi/c1-22(2,3)9-8-19-21(16,17)20-12-7-5-4-6-11(12)10-18-13(14)15/h4-7H,8-10H2,1-3H3,(H2,14,15)(H,16,17) |
| InChIKey | LSXOPLRUSJTYGB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|