C25H39FN5O6PSSi2 — CID 87309817
[2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-fluorophenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate (PubChem CID 87309817) has the molecular formula C25H39FN5O6PSSi2 and a molecular weight of 643.83 g/mol. Its IUPAC name is [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-fluorophenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate.
| Compound Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-fluorophenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 87309817 |
| Molecular Formula | C25H39FN5O6PSSi2 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-fluorophenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate |
| SMILES | C[Si](C)(C)CCOP(=O)(OCC[Si](C)(C)C)Oc1ccc(F)cc1COC(=O)Nc1cccnc1C=NNC(N)=S |
| InChI | InChI=1S/C25H39FN5O6PSSi2/c1-40(2,3)14-12-35-38(33,36-13-15-41(4,5)6)37-23-10-9-20(26)16-19(23)18-34-25(32)30-21-8-7-11-28-22(21)17-29-31-24(27)39/h7-11,16-17H,12-15,18H2,1-6H3,(H,30,32)(H3,27,31,39) |
| InChIKey | BXMWKPQVACWDKL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|