C26H42N5O7PSSi2 — CID 87617645
[2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-methoxyphenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate (PubChem CID 87617645) has the molecular formula C26H42N5O7PSSi2 and a molecular weight of 655.86 g/mol. Its IUPAC name is [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-methoxyphenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate.
| Compound Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-methoxyphenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 87617645 |
| Molecular Formula | C26H42N5O7PSSi2 |
| Molecular Weight | 655.86 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-methoxyphenyl]methyl N-[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamate |
| SMILES | COc1ccc(OP(=O)(OCC[Si](C)(C)C)OCC[Si](C)(C)C)c(COC(=O)Nc2cccnc2C=NNC(N)=S)c1 |
| InChI | InChI=1S/C26H42N5O7PSSi2/c1-34-21-10-11-24(38-39(33,36-13-15-41(2,3)4)37-14-16-42(5,6)7)20(17-21)19-35-26(32)30-22-9-8-12-28-23(22)18-29-31-25(27)40/h8-12,17-18H,13-16,19H2,1-7H3,(H,30,32)(H3,27,31,40) |
| InChIKey | CGMHHJJQTXBKED-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.86 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|