C15H12Cl2N5Na2O6PS — CID 87310089
disodium;[2-[[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamoyloxymethyl]-4,6-dichlorophenyl] phosphate (PubChem CID 87310089) has the molecular formula C15H12Cl2N5Na2O6PS and a molecular weight of 538.22 g/mol. Its IUPAC name is disodium;[2-[[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamoyloxymethyl]-4,6-dichlorophenyl] phosphate.
| Compound Name | disodium;[2-[[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamoyloxymethyl]-4,6-dichlorophenyl] phosphate |
|---|---|
| PubChem CID | 87310089 |
| Molecular Formula | C15H12Cl2N5Na2O6PS |
| Molecular Weight | 538.22 g/mol |
| Exact Mass | 536.94 |
| IUPAC Name | disodium;[2-[[2-[(carbamothioylhydrazinylidene)methyl]-3-pyridinyl]carbamoyloxymethyl]-4,6-dichlorophenyl] phosphate |
| SMILES | NC(=S)NN=Cc1ncccc1NC(=O)OCc1cc(Cl)cc(Cl)c1OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C15H14Cl2N5O6PS.2Na/c16-9-4-8(13(10(17)5-9)28-29(24,25)26)7-27-15(23)21-11-2-1-3-19-12(11)6-20-22-14(18)30;;/h1-6H,7H2,(H,21,23)(H3,18,22,30)(H2,24,25,26);;/q;2*+1/p-2 |
| InChIKey | DYWVVSTWTLFVKT-UHFFFAOYSA-L |
| XLogP | -4.48 |
| TPSA | 174.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.22 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|