C11H14O3 — CID 139986974
2-(2-but-3-ynyl-3-oxocyclopentyl)acetic acid (PubChem CID 139986974) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(2-but-3-ynyl-3-oxocyclopentyl)acetic acid.
| Compound Name | 2-(2-but-3-ynyl-3-oxocyclopentyl)acetic acid |
|---|---|
| PubChem CID | 139986974 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(2-but-3-ynyl-3-oxocyclopentyl)acetic acid |
| SMILES | C#CCCC1C(=O)CCC1CC(=O)O |
| InChI | InChI=1S/C11H14O3/c1-2-3-4-9-8(7-11(13)14)5-6-10(9)12/h1,8-9H,3-7H2,(H,13,14) |
| InChIKey | XVSPMGLOYSSHNG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|