2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid

C14H18O2 — CID 139988414

IUPAC2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid
SMILESO=C(O)CC1CC2CC23C2C=CC(C2)C3C1
InChIInChI=1S/C14H18O2/c15-13(16)5-8-3-11-7-14(11)10-2-1-9(6-10)12(14)4-8/h1-2,8-12H,3-7H2,(H,15,16)
InChIKeyYNLQIUAMKTZYCN-UHFFFAOYSA-N
MW218.30 g/mol
LogP2.70
Rot. Bonds2

About 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid

2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid (PubChem CID 139988414) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid.

Molecular Properties

Compound Name2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid
PubChem CID139988414
Molecular FormulaC14H18O2
Molecular Weight218.30 g/mol
Exact Mass218.13
IUPAC Name2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid
SMILESO=C(O)CC1CC2CC23C2C=CC(C2)C3C1
InChIInChI=1S/C14H18O2/c15-13(16)5-8-3-11-7-14(11)10-2-1-9(6-10)12(14)4-8/h1-2,8-12H,3-7H2,(H,15,16)
InChIKeyYNLQIUAMKTZYCN-UHFFFAOYSA-N
XLogP2.70
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.30
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid?
The IUPAC name of 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid (CID 139988414) is 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid.
What is the SMILES notation for 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid?
The canonical SMILES for 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid is O=C(O)CC1CC2CC23C2C=CC(C2)C3C1.
What is the InChIKey of 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid?
The InChIKey is YNLQIUAMKTZYCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c15-13(16)5-8-3-11-7-14(11)10-2-1-9(6-10)12(14)4-8/h1-2,8-12H,3-7H2,(H,15,16).
What are the key properties of 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid?
2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid has a molecular weight of 218.30 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-tetracyclo[7.2.1.02,4.02,8]dodec-10-enyl)acetic acid is sourced from PubChem (CID 139988414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).