C38H26F12O5S3 — CID 139989988
[[4-(2-benzoyl-3-methylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139989988) has the molecular formula C38H26F12O5S3 and a molecular weight of 886.80 g/mol. Its IUPAC name is [[4-(2-benzoyl-3-methylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-(2-benzoyl-3-methylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139989988 |
| Molecular Formula | C38H26F12O5S3 |
| Molecular Weight | 886.80 g/mol |
| Exact Mass | 886.08 |
| IUPAC Name | [[4-(2-benzoyl-3-methylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(Sc3cccc(C)c3C(=O)c3ccccc3)cc2)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H26F12O5S3/c1-23-9-8-13-30(32(23)33(51)24-10-4-3-5-11-24)56-26-17-21-28(22-18-26)57(27-19-15-25(54-2)16-20-27,31-14-7-6-12-29(31)34(39,40)41)55-58(52,53)38(49,50)36(44,45)35(42,43)37(46,47)48/h3-22H,1-2H3 |
| InChIKey | JBUNFKQDFNDIRN-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.80 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|