C10H20N2O — CID 139990771
3-(1-methoxyethyl)heptane-1,6-diimine (PubChem CID 139990771) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-(1-methoxyethyl)heptane-1,6-diimine.
| Compound Name | 3-(1-methoxyethyl)heptane-1,6-diimine |
|---|---|
| PubChem CID | 139990771 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-(1-methoxyethyl)heptane-1,6-diimine |
| SMILES | [H]/N=C/CC(CC/C(C)=N/[H])C(C)OC |
| InChI | InChI=1S/C10H20N2O/c1-8(12)4-5-10(6-7-11)9(2)13-3/h7,9-12H,4-6H2,1-3H3/b11-7+,12-8+ |
| InChIKey | JWBFKURUQBYNJB-MKICQXMISA-N |
| XLogP | 2.50 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|