C11H22N2O — CID 139990769
3-(1-ethoxyethyl)heptane-1,6-diimine (PubChem CID 139990769) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-(1-ethoxyethyl)heptane-1,6-diimine.
| Compound Name | 3-(1-ethoxyethyl)heptane-1,6-diimine |
|---|---|
| PubChem CID | 139990769 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 3-(1-ethoxyethyl)heptane-1,6-diimine |
| SMILES | [H]/N=C/CC(CC/C(C)=N/[H])C(C)OCC |
| InChI | InChI=1S/C11H22N2O/c1-4-14-10(3)11(7-8-12)6-5-9(2)13/h8,10-13H,4-7H2,1-3H3/b12-8+,13-9+ |
| InChIKey | XCVYTWVHGOXDFR-QHKWOANTSA-N |
| XLogP | 2.89 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|