C28H30N2O5 — CID 139992497
3-[6-(2,5-diaminophenoxy)hexoxy]-6-methoxy-2-phenylchromen-4-one (PubChem CID 139992497) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[6-(2,5-diaminophenoxy)hexoxy]-6-methoxy-2-phenylchromen-4-one.
| Compound Name | 3-[6-(2,5-diaminophenoxy)hexoxy]-6-methoxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 139992497 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 3-[6-(2,5-diaminophenoxy)hexoxy]-6-methoxy-2-phenylchromen-4-one |
| SMILES | COc1ccc2oc(-c3ccccc3)c(OCCCCCCOc3cc(N)ccc3N)c(=O)c2c1 |
| InChI | InChI=1S/C28H30N2O5/c1-32-21-12-14-24-22(18-21)26(31)28(27(35-24)19-9-5-4-6-10-19)34-16-8-3-2-7-15-33-25-17-20(29)11-13-23(25)30/h4-6,9-14,17-18H,2-3,7-8,15-16,29-30H2,1H3 |
| InChIKey | NOEULFWIQPZRLO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|