About potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate
potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate (PubChem CID 139993063) has the molecular formula C5H11KN2OS2
and a molecular weight of 218.39 g/mol. Its IUPAC name is potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate.
Molecular Properties
| Compound Name | potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate |
| PubChem CID | 139993063 |
| Molecular Formula | C5H11KN2OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate |
| SMILES | O.S=C([S-])NN1CCCC1.[K+] |
| InChI | InChI=1S/C5H10N2S2.K.H2O/c8-5(9)6-7-3-1-2-4-7;;/h1-4H2,(H2,6,8,9);;1H2/q;+1;/p-1 |
| InChIKey | QJOGWHKPAFKDSP-UHFFFAOYSA-M |
| XLogP | -3.40 |
| TPSA | 46.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate?
The IUPAC name of potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate (CID 139993063) is potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate.
What is the SMILES notation for potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate?
The canonical SMILES for potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate is O.S=C([S-])NN1CCCC1.[K+].
What is the InChIKey of potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate?
The InChIKey is QJOGWHKPAFKDSP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10N2S2.K.H2O/c8-5(9)6-7-3-1-2-4-7;;/h1-4H2,(H2,6,8,9);;1H2/q;+1;/p-1.
What are the key properties of potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate?
potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate has a molecular weight of 218.39 g/mol, XLogP of -3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;N-pyrrolidin-1-ylcarbamodithioate;hydrate is sourced from PubChem (CID 139993063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).