C22H34O — CID 139994314
(2E)-8-methyl-4-methylidene-1-[(2E)-8-methyl-4-methylidenenona-2,7-dienoxy]nona-2,7-diene (PubChem CID 139994314) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is (2E)-8-methyl-4-methylidene-1-[(2E)-8-methyl-4-methylidenenona-2,7-dienoxy]nona-2,7-diene.
| Compound Name | (2E)-8-methyl-4-methylidene-1-[(2E)-8-methyl-4-methylidenenona-2,7-dienoxy]nona-2,7-diene |
|---|---|
| PubChem CID | 139994314 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (2E)-8-methyl-4-methylidene-1-[(2E)-8-methyl-4-methylidenenona-2,7-dienoxy]nona-2,7-diene |
| SMILES | C=C(/C=C/COC/C=C/C(=C)CCC=C(C)C)CCC=C(C)C |
| InChI | InChI=1S/C22H34O/c1-19(2)11-7-13-21(5)15-9-17-23-18-10-16-22(6)14-8-12-20(3)4/h9-12,15-16H,5-8,13-14,17-18H2,1-4H3/b15-9+,16-10+ |
| InChIKey | MJXVQWBZOFWDRM-KAVGSWPWSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|