C24H45NO3 — CID 139996527
(2,6,6-trimethyl-13-morpholin-4-yltridecyl) 2-methylprop-2-enoate (PubChem CID 139996527) has the molecular formula C24H45NO3 and a molecular weight of 395.63 g/mol. Its IUPAC name is (2,6,6-trimethyl-13-morpholin-4-yltridecyl) 2-methylprop-2-enoate.
| Compound Name | (2,6,6-trimethyl-13-morpholin-4-yltridecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139996527 |
| Molecular Formula | C24H45NO3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.34 |
| IUPAC Name | (2,6,6-trimethyl-13-morpholin-4-yltridecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)CCCC(C)(C)CCCCCCCN1CCOCC1 |
| InChI | InChI=1S/C24H45NO3/c1-21(2)23(26)28-20-22(3)12-11-14-24(4,5)13-9-7-6-8-10-15-25-16-18-27-19-17-25/h22H,1,6-20H2,2-5H3 |
| InChIKey | LWRULRAYRQEPRW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|