C27H30N4O5 — CID 139997812
(E)-2-acetyl-N-[1-[3-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-6-yl]ethyl]-5-phenylpent-2-enamide (PubChem CID 139997812) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is (E)-2-acetyl-N-[1-[3-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-6-yl]ethyl]-5-phenylpent-2-enamide.
| Compound Name | (E)-2-acetyl-N-[1-[3-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-6-yl]ethyl]-5-phenylpent-2-enamide |
|---|---|
| PubChem CID | 139997812 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (E)-2-acetyl-N-[1-[3-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-6-yl]ethyl]-5-phenylpent-2-enamide |
| SMILES | COc1ccc(Cc2nnc(C(C)NC(=O)/C(=C/CCc3ccccc3)C(C)=O)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C27H30N4O5/c1-17(28-26(33)21(18(2)32)12-8-11-19-9-6-5-7-10-19)25-27(34)29-24(30-31-25)16-20-13-14-22(35-3)23(15-20)36-4/h5-7,9-10,12-15,17H,8,11,16H2,1-4H3,(H,28,33)(H,29,30,34)/b21-12+ |
| InChIKey | WXSCGHGTSRKUBZ-CIAFOILYSA-N |
| XLogP | 3.10 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|