C15H24O2S — CID 139998314
octyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 139998314) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is octyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | octyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 139998314 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | octyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CC2C=CC1S2 |
| InChI | InChI=1S/C15H24O2S/c1-2-3-4-5-6-7-10-17-15(16)13-11-12-8-9-14(13)18-12/h8-9,12-14H,2-7,10-11H2,1H3 |
| InChIKey | JODIDTQIOJCXHF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|